C14H13FN2OS — CID 65041385
5-fluoro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzaldehyde (PubChem CID 65041385) has the molecular formula C14H13FN2OS and a molecular weight of 276.34 g/mol. Its IUPAC name is 5-fluoro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzaldehyde.
| Compound Name | 5-fluoro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzaldehyde |
|---|---|
| PubChem CID | 65041385 |
| Molecular Formula | C14H13FN2OS |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-fluoro-2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbenzaldehyde |
| SMILES | Cc1nc(Sc2ccc(F)cc2C=O)nc(C)c1C |
| InChI | InChI=1S/C14H13FN2OS/c1-8-9(2)16-14(17-10(8)3)19-13-5-4-12(15)6-11(13)7-18/h4-7H,1-3H3 |
| InChIKey | SREAKAGDRWROPJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|