C13H30N2O2S — CID 65042305
N-(3-ethylpentan-3-yl)-3-(propan-2-ylamino)propane-1-sulfonamide (PubChem CID 65042305) has the molecular formula C13H30N2O2S and a molecular weight of 278.46 g/mol. Its IUPAC name is N-(3-ethylpentan-3-yl)-3-(propan-2-ylamino)propane-1-sulfonamide.
| Compound Name | N-(3-ethylpentan-3-yl)-3-(propan-2-ylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 65042305 |
| Molecular Formula | C13H30N2O2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | N-(3-ethylpentan-3-yl)-3-(propan-2-ylamino)propane-1-sulfonamide |
| SMILES | CCC(CC)(CC)NS(=O)(=O)CCCNC(C)C |
| InChI | InChI=1S/C13H30N2O2S/c1-6-13(7-2,8-3)15-18(16,17)11-9-10-14-12(4)5/h12,14-15H,6-11H2,1-5H3 |
| InChIKey | FJDGUEFAGAJSCR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|