C17H32N2O2 — CID 65043214
3,3,6-triethyl-1-(3-ethylpentan-3-yl)piperazine-2,5-dione (PubChem CID 65043214) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 3,3,6-triethyl-1-(3-ethylpentan-3-yl)piperazine-2,5-dione.
| Compound Name | 3,3,6-triethyl-1-(3-ethylpentan-3-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 65043214 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 3,3,6-triethyl-1-(3-ethylpentan-3-yl)piperazine-2,5-dione |
| SMILES | CCC1C(=O)NC(CC)(CC)C(=O)N1C(CC)(CC)CC |
| InChI | InChI=1S/C17H32N2O2/c1-7-13-14(20)18-17(11-5,12-6)15(21)19(13)16(8-2,9-3)10-4/h13H,7-12H2,1-6H3,(H,18,20) |
| InChIKey | QTVMRHKHJFFUBP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |