About 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide
2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide (PubChem CID 65043472) has the molecular formula C11H18N4OS
and a molecular weight of 254.36 g/mol. Its IUPAC name is 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide.
Molecular Properties
| Compound Name | 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide |
| PubChem CID | 65043472 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide |
| SMILES | Cc1nc(SCCC(N)C(N)=O)nc(C)c1C |
| InChI | InChI=1S/C11H18N4OS/c1-6-7(2)14-11(15-8(6)3)17-5-4-9(12)10(13)16/h9H,4-5,12H2,1-3H3,(H2,13,16) |
| InChIKey | VUDGMPDXJRQFQZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide?
The IUPAC name of 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide (CID 65043472) is 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide.
What is the SMILES notation for 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide?
The canonical SMILES for 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide is Cc1nc(SCCC(N)C(N)=O)nc(C)c1C.
What is the InChIKey of 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide?
The InChIKey is VUDGMPDXJRQFQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4OS/c1-6-7(2)14-11(15-8(6)3)17-5-4-9(12)10(13)16/h9H,4-5,12H2,1-3H3,(H2,13,16).
What are the key properties of 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide?
2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide has a molecular weight of 254.36 g/mol, XLogP of 0.70, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(4,5,6-trimethylpyrimidin-2-yl)sulfanylbutanamide is sourced from PubChem (CID 65043472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).