About 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine
2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine (PubChem CID 65043880) has the molecular formula C15H25N3O2S
and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine |
| PubChem CID | 65043880 |
| Molecular Formula | C15H25N3O2S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine |
| SMILES | CCN(CC)c1ccc(NC2CCCC2S(C)(=O)=O)cn1 |
| InChI | InChI=1S/C15H25N3O2S/c1-4-18(5-2)15-10-9-12(11-16-15)17-13-7-6-8-14(13)21(3,19)20/h9-11,13-14,17H,4-8H2,1-3H3 |
| InChIKey | QWIJMJSQHQIKRX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine?
The IUPAC name of 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine (CID 65043880) is 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine.
What is the SMILES notation for 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine?
The canonical SMILES for 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine is CCN(CC)c1ccc(NC2CCCC2S(C)(=O)=O)cn1.
What is the InChIKey of 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine?
The InChIKey is QWIJMJSQHQIKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2S/c1-4-18(5-2)15-10-9-12(11-16-15)17-13-7-6-8-14(13)21(3,19)20/h9-11,13-14,17H,4-8H2,1-3H3.
What are the key properties of 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine?
2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine has a molecular weight of 311.45 g/mol, XLogP of 2.31, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-diethyl-5-N-(2-methylsulfonylcyclopentyl)pyridine-2,5-diamine is sourced from PubChem (CID 65043880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).