C15H21NO4S — CID 65043932
methyl 2-methyl-3-[(2-methylsulfonylcyclopentyl)amino]benzoate (PubChem CID 65043932) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is methyl 2-methyl-3-[(2-methylsulfonylcyclopentyl)amino]benzoate.
| Compound Name | methyl 2-methyl-3-[(2-methylsulfonylcyclopentyl)amino]benzoate |
|---|---|
| PubChem CID | 65043932 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | methyl 2-methyl-3-[(2-methylsulfonylcyclopentyl)amino]benzoate |
| SMILES | COC(=O)c1cccc(NC2CCCC2S(C)(=O)=O)c1C |
| InChI | InChI=1S/C15H21NO4S/c1-10-11(15(17)20-2)6-4-7-12(10)16-13-8-5-9-14(13)21(3,18)19/h4,6-7,13-14,16H,5,8-9H2,1-3H3 |
| InChIKey | PZUCZVTYWBPFCO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |