C10H22N2O3S — CID 65044744
1-(aminomethyl)-N-(2-methoxyethyl)-2-methylsulfonylcyclopentan-1-amine (PubChem CID 65044744) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is 1-(aminomethyl)-N-(2-methoxyethyl)-2-methylsulfonylcyclopentan-1-amine.
| Compound Name | 1-(aminomethyl)-N-(2-methoxyethyl)-2-methylsulfonylcyclopentan-1-amine |
|---|---|
| PubChem CID | 65044744 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(aminomethyl)-N-(2-methoxyethyl)-2-methylsulfonylcyclopentan-1-amine |
| SMILES | COCCNC1(CN)CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O3S/c1-15-7-6-12-10(8-11)5-3-4-9(10)16(2,13)14/h9,12H,3-8,11H2,1-2H3 |
| InChIKey | QMNVNEZLLSEAHN-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|