C10H21NO4S — CID 103377338
3-[1-(aminomethyl)-2-methylsulfonylcyclopentyl]oxypropan-1-ol (PubChem CID 103377338) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-[1-(aminomethyl)-2-methylsulfonylcyclopentyl]oxypropan-1-ol.
| Compound Name | 3-[1-(aminomethyl)-2-methylsulfonylcyclopentyl]oxypropan-1-ol |
|---|---|
| PubChem CID | 103377338 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-[1-(aminomethyl)-2-methylsulfonylcyclopentyl]oxypropan-1-ol |
| SMILES | CS(=O)(=O)C1CCCC1(CN)OCCCO |
| InChI | InChI=1S/C10H21NO4S/c1-16(13,14)9-4-2-5-10(9,8-11)15-7-3-6-12/h9,12H,2-8,11H2,1H3 |
| InChIKey | PNIVSLYTERURPL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|