C10H21NO3S — CID 66092167
2-[1-(1-aminoethyl)-2-methylsulfonylcyclopentyl]ethanol (PubChem CID 66092167) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is 2-[1-(1-aminoethyl)-2-methylsulfonylcyclopentyl]ethanol.
| Compound Name | 2-[1-(1-aminoethyl)-2-methylsulfonylcyclopentyl]ethanol |
|---|---|
| PubChem CID | 66092167 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-[1-(1-aminoethyl)-2-methylsulfonylcyclopentyl]ethanol |
| SMILES | CC(N)C1(CCO)CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C10H21NO3S/c1-8(11)10(6-7-12)5-3-4-9(10)15(2,13)14/h8-9,12H,3-7,11H2,1-2H3 |
| InChIKey | NTKQWDOPQNFOFT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |