C18H27NO — CID 65051582
[1-(2,3-dihydro-1H-inden-5-ylmethoxy)cycloheptyl]methanamine (PubChem CID 65051582) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is [1-(2,3-dihydro-1H-inden-5-ylmethoxy)cycloheptyl]methanamine.
| Compound Name | [1-(2,3-dihydro-1H-inden-5-ylmethoxy)cycloheptyl]methanamine |
|---|---|
| PubChem CID | 65051582 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | [1-(2,3-dihydro-1H-inden-5-ylmethoxy)cycloheptyl]methanamine |
| SMILES | NCC1(OCc2ccc3c(c2)CCC3)CCCCCC1 |
| InChI | InChI=1S/C18H27NO/c19-14-18(10-3-1-2-4-11-18)20-13-15-8-9-16-6-5-7-17(16)12-15/h8-9,12H,1-7,10-11,13-14,19H2 |
| InChIKey | CZGRGOQETVQJLH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |