C24H17N3O3 — CID 6505234
2-[[4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile (PubChem CID 6505234) has the molecular formula C24H17N3O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is 2-[[4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 6505234 |
| Molecular Formula | C24H17N3O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[[4-[(E)-(3,5-dioxo-1-phenylpyrazolidin-4-ylidene)methyl]phenoxy]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1COc1ccc(/C=C2\C(=O)NN(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C24H17N3O3/c25-15-18-6-4-5-7-19(18)16-30-21-12-10-17(11-13-21)14-22-23(28)26-27(24(22)29)20-8-2-1-3-9-20/h1-14H,16H2,(H,26,28)/b22-14+ |
| InChIKey | HNXPPNJLSVYCBU-HYARGMPZSA-N |
| XLogP | 3.60 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|