C18H27NO2 — CID 65055124
3-[cyclopropyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]propanoic acid (PubChem CID 65055124) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-[cyclopropyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 65055124 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-[cyclopropyl-[1-[4-(2-methylpropyl)phenyl]ethyl]amino]propanoic acid |
| SMILES | CC(C)Cc1ccc(C(C)N(CCC(=O)O)C2CC2)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-13(2)12-15-4-6-16(7-5-15)14(3)19(17-8-9-17)11-10-18(20)21/h4-7,13-14,17H,8-12H2,1-3H3,(H,20,21) |
| InChIKey | NFBQIPMBMKAUIS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |