C15H22N2O2 — CID 65058019
2-[cyclopropyl-[1-[4-(dimethylamino)phenyl]ethyl]amino]acetic acid (PubChem CID 65058019) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[cyclopropyl-[1-[4-(dimethylamino)phenyl]ethyl]amino]acetic acid.
| Compound Name | 2-[cyclopropyl-[1-[4-(dimethylamino)phenyl]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 65058019 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 2-[cyclopropyl-[1-[4-(dimethylamino)phenyl]ethyl]amino]acetic acid |
| SMILES | CC(c1ccc(N(C)C)cc1)N(CC(=O)O)C1CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-11(17(10-15(18)19)14-8-9-14)12-4-6-13(7-5-12)16(2)3/h4-7,11,14H,8-10H2,1-3H3,(H,18,19) |
| InChIKey | KQCXPQMERQTGKO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|