2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid

C15H14ClNO4 — CID 65057701

IUPAC2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid
SMILESO=C(O)CN(Cc1ccc(O)cc1O)c1ccc(Cl)cc1
InChIInChI=1S/C15H14ClNO4/c16-11-2-4-12(5-3-11)17(9-15(20)21)8-10-1-6-13(18)7-14(10)19/h1-7,18-19H,8-9H2,(H,20,21)
InChIKeyMPWSZIMEOZSJPE-UHFFFAOYSA-N
MW307.73 g/mol
LogP2.84
Rot. Bonds5

About 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid

2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid (PubChem CID 65057701) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid.

Molecular Properties

Compound Name2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid
PubChem CID65057701
Molecular FormulaC15H14ClNO4
Molecular Weight307.73 g/mol
Exact Mass307.06
IUPAC Name2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid
SMILESO=C(O)CN(Cc1ccc(O)cc1O)c1ccc(Cl)cc1
InChIInChI=1S/C15H14ClNO4/c16-11-2-4-12(5-3-11)17(9-15(20)21)8-10-1-6-13(18)7-14(10)19/h1-7,18-19H,8-9H2,(H,20,21)
InChIKeyMPWSZIMEOZSJPE-UHFFFAOYSA-N
XLogP2.84
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500307.73
LogP ≤ 52.84
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}

Analyze 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid?
The IUPAC name of 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid (CID 65057701) is 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid.
What is the SMILES notation for 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid?
The canonical SMILES for 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid is O=C(O)CN(Cc1ccc(O)cc1O)c1ccc(Cl)cc1.
What is the InChIKey of 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid?
The InChIKey is MPWSZIMEOZSJPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClNO4/c16-11-2-4-12(5-3-11)17(9-15(20)21)8-10-1-6-13(18)7-14(10)19/h1-7,18-19H,8-9H2,(H,20,21).
What are the key properties of 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid?
2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid has a molecular weight of 307.73 g/mol, XLogP of 2.84, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid is sourced from PubChem (CID 65057701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).