C15H14ClNO4 — CID 65057701
2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid (PubChem CID 65057701) has the molecular formula C15H14ClNO4 and a molecular weight of 307.73 g/mol. Its IUPAC name is 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid.
| Compound Name | 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid |
|---|---|
| PubChem CID | 65057701 |
| Molecular Formula | C15H14ClNO4 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-[4-chloro-N-[(2,4-dihydroxyphenyl)methyl]anilino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccc(O)cc1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO4/c16-11-2-4-12(5-3-11)17(9-15(20)21)8-10-1-6-13(18)7-14(10)19/h1-7,18-19H,8-9H2,(H,20,21) |
| InChIKey | MPWSZIMEOZSJPE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|