C13H11Cl2NO2S — CID 79428121
2-[4-chloro-N-[(4-chlorothiophen-2-yl)methyl]anilino]acetic acid (PubChem CID 79428121) has the molecular formula C13H11Cl2NO2S and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-[4-chloro-N-[(4-chlorothiophen-2-yl)methyl]anilino]acetic acid.
| Compound Name | 2-[4-chloro-N-[(4-chlorothiophen-2-yl)methyl]anilino]acetic acid |
|---|---|
| PubChem CID | 79428121 |
| Molecular Formula | C13H11Cl2NO2S |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 2-[4-chloro-N-[(4-chlorothiophen-2-yl)methyl]anilino]acetic acid |
| SMILES | O=C(O)CN(Cc1cc(Cl)cs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11Cl2NO2S/c14-9-1-3-11(4-2-9)16(7-13(17)18)6-12-5-10(15)8-19-12/h1-5,8H,6-7H2,(H,17,18) |
| InChIKey | KCNOEXKACCUWQJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |