C13H17ClFNO2 — CID 65060651
3-[(4-chloro-3-fluorophenyl)methyl-ethylamino]butanoic acid (PubChem CID 65060651) has the molecular formula C13H17ClFNO2 and a molecular weight of 273.73 g/mol. Its IUPAC name is 3-[(4-chloro-3-fluorophenyl)methyl-ethylamino]butanoic acid.
| Compound Name | 3-[(4-chloro-3-fluorophenyl)methyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 65060651 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.73 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[(4-chloro-3-fluorophenyl)methyl-ethylamino]butanoic acid |
| SMILES | CCN(Cc1ccc(Cl)c(F)c1)C(C)CC(=O)O |
| InChI | InChI=1S/C13H17ClFNO2/c1-3-16(9(2)6-13(17)18)8-10-4-5-11(14)12(15)7-10/h4-5,7,9H,3,6,8H2,1-2H3,(H,17,18) |
| InChIKey | GPLHRIQMJHEFDT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.73 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |