About 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid
3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid (PubChem CID 65061319) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid.
Analyze 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
The IUPAC name of 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid (CID 65061319) is 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid.
What is the SMILES notation for 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
The canonical SMILES for 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid is CCN(CC(C)C(=O)O)CC(C)(C)C.
What is the InChIKey of 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
The InChIKey is FCROTHPQQHBKSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-6-12(8-11(3,4)5)7-9(2)10(13)14/h9H,6-8H2,1-5H3,(H,13,14).
What are the key properties of 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid?
3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid has a molecular weight of 201.31 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-dimethylpropyl(ethyl)amino]-2-methylpropanoic acid is sourced from PubChem (CID 65061319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).