C9H16ClNO2 — CID 76950809
3-[3-chloroprop-2-enyl(ethyl)amino]-2-methylpropanoic acid (PubChem CID 76950809) has the molecular formula C9H16ClNO2 and a molecular weight of 205.69 g/mol. Its IUPAC name is 3-[3-chloroprop-2-enyl(ethyl)amino]-2-methylpropanoic acid.
| Compound Name | 3-[3-chloroprop-2-enyl(ethyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 76950809 |
| Molecular Formula | C9H16ClNO2 |
| Molecular Weight | 205.69 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 3-[3-chloroprop-2-enyl(ethyl)amino]-2-methylpropanoic acid |
| SMILES | CCN(CC=CCl)CC(C)C(=O)O |
| InChI | InChI=1S/C9H16ClNO2/c1-3-11(6-4-5-10)7-8(2)9(12)13/h4-5,8H,3,6-7H2,1-2H3,(H,12,13) |
| InChIKey | FENDTMHPZADMTD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |