C15H28N2O2 — CID 65061888
2-[4-(3,3-dimethylcyclohexyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 65061888) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-[4-(3,3-dimethylcyclohexyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(3,3-dimethylcyclohexyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 65061888 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2-[4-(3,3-dimethylcyclohexyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | CC1(C)CCCC(N2CCCN(CC(=O)O)CC2)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-15(2)6-3-5-13(11-15)17-8-4-7-16(9-10-17)12-14(18)19/h13H,3-12H2,1-2H3,(H,18,19) |
| InChIKey | JBDKMNYSULOXMQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |