C15H20FNO2 — CID 65064332
3-ethyl-1-[1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid (PubChem CID 65064332) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is 3-ethyl-1-[1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-ethyl-1-[1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65064332 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-ethyl-1-[1-(4-fluorophenyl)ethyl]pyrrolidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(C(C)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C15H20FNO2/c1-3-15(14(18)19)8-9-17(10-15)11(2)12-4-6-13(16)7-5-12/h4-7,11H,3,8-10H2,1-2H3,(H,18,19) |
| InChIKey | VCNKZMFFBLEJID-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |