C16H21F2NO2 — CID 65068630
1-[1-(2,5-difluorophenyl)ethyl]-3-ethylpiperidine-3-carboxylic acid (PubChem CID 65068630) has the molecular formula C16H21F2NO2 and a molecular weight of 297.34 g/mol. Its IUPAC name is 1-[1-(2,5-difluorophenyl)ethyl]-3-ethylpiperidine-3-carboxylic acid.
| Compound Name | 1-[1-(2,5-difluorophenyl)ethyl]-3-ethylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 65068630 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 1-[1-(2,5-difluorophenyl)ethyl]-3-ethylpiperidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCCN(C(C)c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C16H21F2NO2/c1-3-16(15(20)21)7-4-8-19(10-16)11(2)13-9-12(17)5-6-14(13)18/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,20,21) |
| InChIKey | CWGRJJCUJFGKLL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |