C12H18N4O4 — CID 65071057
2-[1-[[1-(2-hydroxyethyl)pyrazol-4-yl]methyl]-3-oxopiperazin-2-yl]acetic acid (PubChem CID 65071057) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[1-[[1-(2-hydroxyethyl)pyrazol-4-yl]methyl]-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-[[1-(2-hydroxyethyl)pyrazol-4-yl]methyl]-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 65071057 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[1-[[1-(2-hydroxyethyl)pyrazol-4-yl]methyl]-3-oxopiperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1C(=O)NCCN1Cc1cnn(CCO)c1 |
| InChI | InChI=1S/C12H18N4O4/c17-4-3-16-8-9(6-14-16)7-15-2-1-13-12(20)10(15)5-11(18)19/h6,8,10,17H,1-5,7H2,(H,13,20)(H,18,19) |
| InChIKey | GMYCQYJWTHNBAG-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |