C13H12N2O4S2 — CID 65071912
5-[(5-nitrothiophen-3-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-4-carboxylic acid (PubChem CID 65071912) has the molecular formula C13H12N2O4S2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 5-[(5-nitrothiophen-3-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-4-carboxylic acid.
| Compound Name | 5-[(5-nitrothiophen-3-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 65071912 |
| Molecular Formula | C13H12N2O4S2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 5-[(5-nitrothiophen-3-yl)methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine-4-carboxylic acid |
| SMILES | O=C(O)C1c2ccsc2CCN1Cc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N2O4S2/c16-13(17)12-9-2-4-20-10(9)1-3-14(12)6-8-5-11(15(18)19)21-7-8/h2,4-5,7,12H,1,3,6H2,(H,16,17) |
| InChIKey | YHNMYYOMVWUWEX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|