C12H17N3O3S — CID 95308262
(3S,6S)-6-methyl-1-[(5-nitrothiophen-3-yl)methyl]piperidine-3-carboxamide (PubChem CID 95308262) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is (3S,6S)-6-methyl-1-[(5-nitrothiophen-3-yl)methyl]piperidine-3-carboxamide.
| Compound Name | (3S,6S)-6-methyl-1-[(5-nitrothiophen-3-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95308262 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (3S,6S)-6-methyl-1-[(5-nitrothiophen-3-yl)methyl]piperidine-3-carboxamide |
| SMILES | C[C@H]1CC[C@H](C(N)=O)CN1Cc1csc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H17N3O3S/c1-8-2-3-10(12(13)16)6-14(8)5-9-4-11(15(17)18)19-7-9/h4,7-8,10H,2-3,5-6H2,1H3,(H2,13,16)/t8-,10-/m0/s1 |
| InChIKey | APMDQOZLQKPZEZ-WPRPVWTQSA-N |
| XLogP | 1.74 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|