C14H20BrN3O — CID 115557109
1-[(3-amino-4-bromophenyl)methyl]-6-methylpiperidine-3-carboxamide (PubChem CID 115557109) has the molecular formula C14H20BrN3O and a molecular weight of 326.24 g/mol. Its IUPAC name is 1-[(3-amino-4-bromophenyl)methyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-[(3-amino-4-bromophenyl)methyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 115557109 |
| Molecular Formula | C14H20BrN3O |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 1-[(3-amino-4-bromophenyl)methyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1Cc1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C14H20BrN3O/c1-9-2-4-11(14(17)19)8-18(9)7-10-3-5-12(15)13(16)6-10/h3,5-6,9,11H,2,4,7-8,16H2,1H3,(H2,17,19) |
| InChIKey | ODJHYXJNUDJNQV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|