C17H24N2O2 — CID 65072333
ethyl 4-[(1-ethylindol-3-yl)methylamino]butanoate (PubChem CID 65072333) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is ethyl 4-[(1-ethylindol-3-yl)methylamino]butanoate.
| Compound Name | ethyl 4-[(1-ethylindol-3-yl)methylamino]butanoate |
|---|---|
| PubChem CID | 65072333 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ethyl 4-[(1-ethylindol-3-yl)methylamino]butanoate |
| SMILES | CCOC(=O)CCCNCc1cn(CC)c2ccccc12 |
| InChI | InChI=1S/C17H24N2O2/c1-3-19-13-14(15-8-5-6-9-16(15)19)12-18-11-7-10-17(20)21-4-2/h5-6,8-9,13,18H,3-4,7,10-12H2,1-2H3 |
| InChIKey | KECPAIGFMNOZDC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|