C15H19NO3 — CID 80702154
ethyl 4-(1-benzofuran-3-ylmethylamino)butanoate (PubChem CID 80702154) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 4-(1-benzofuran-3-ylmethylamino)butanoate.
| Compound Name | ethyl 4-(1-benzofuran-3-ylmethylamino)butanoate |
|---|---|
| PubChem CID | 80702154 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | ethyl 4-(1-benzofuran-3-ylmethylamino)butanoate |
| SMILES | CCOC(=O)CCCNCc1coc2ccccc12 |
| InChI | InChI=1S/C15H19NO3/c1-2-18-15(17)8-5-9-16-10-12-11-19-14-7-4-3-6-13(12)14/h3-4,6-7,11,16H,2,5,8-10H2,1H3 |
| InChIKey | DGJHHFLRHOQXGP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|