C16H32N4 — CID 65074994
[4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-methylazepan-4-yl]methanamine (PubChem CID 65074994) has the molecular formula C16H32N4 and a molecular weight of 280.46 g/mol. Its IUPAC name is [4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-methylazepan-4-yl]methanamine.
| Compound Name | [4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-methylazepan-4-yl]methanamine |
|---|---|
| PubChem CID | 65074994 |
| Molecular Formula | C16H32N4 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | [4-(1,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-2-yl)-1-methylazepan-4-yl]methanamine |
| SMILES | CN1CCCC(CN)(N2CCCN3CCCC3C2)CC1 |
| InChI | InChI=1S/C16H32N4/c1-18-8-3-6-16(14-17,7-12-18)20-11-4-10-19-9-2-5-15(19)13-20/h15H,2-14,17H2,1H3 |
| InChIKey | CILBNCOVAANSJU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |