C15H30N4 — CID 79932682
[4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-methylpiperidin-4-yl]methanamine (PubChem CID 79932682) has the molecular formula C15H30N4 and a molecular weight of 266.43 g/mol. Its IUPAC name is [4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-methylpiperidin-4-yl]methanamine.
| Compound Name | [4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-methylpiperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 79932682 |
| Molecular Formula | C15H30N4 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | [4-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1-methylpiperidin-4-yl]methanamine |
| SMILES | CN1CCC(CN)(N2CCN3CCCCC3C2)CC1 |
| InChI | InChI=1S/C15H30N4/c1-17-8-5-15(13-16,6-9-17)19-11-10-18-7-3-2-4-14(18)12-19/h14H,2-13,16H2,1H3 |
| InChIKey | BCMCFHAWUQOHHS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 35.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |