C14H27N3S — CID 79950119
[3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-methylthiolan-3-yl]methanamine (PubChem CID 79950119) has the molecular formula C14H27N3S and a molecular weight of 269.46 g/mol. Its IUPAC name is [3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-methylthiolan-3-yl]methanamine.
| Compound Name | [3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-methylthiolan-3-yl]methanamine |
|---|---|
| PubChem CID | 79950119 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | [3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-5-methylthiolan-3-yl]methanamine |
| SMILES | CC1CC(CN)(N2CCN3CCCCC3C2)CS1 |
| InChI | InChI=1S/C14H27N3S/c1-12-8-14(10-15,11-18-12)17-7-6-16-5-3-2-4-13(16)9-17/h12-13H,2-11,15H2,1H3 |
| InChIKey | IHTZWGUQMPISRC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |