About 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide
2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide (PubChem CID 65083577) has the molecular formula C18H28N2O
and a molecular weight of 288.44 g/mol. Its IUPAC name is 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide |
| PubChem CID | 65083577 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccccc1NC1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C18H28N2O/c1-18(2)12-7-8-14(11-13-18)19-16-10-6-5-9-15(16)17(21)20(3)4/h5-6,9-10,14,19H,7-8,11-13H2,1-4H3 |
| InChIKey | BMNMUWDQQRXEEG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide?
The IUPAC name of 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide (CID 65083577) is 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide.
What is the SMILES notation for 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide?
The canonical SMILES for 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide is CN(C)C(=O)c1ccccc1NC1CCCC(C)(C)CC1.
What is the InChIKey of 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide?
The InChIKey is BMNMUWDQQRXEEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O/c1-18(2)12-7-8-14(11-13-18)19-16-10-6-5-9-15(16)17(21)20(3)4/h5-6,9-10,14,19H,7-8,11-13H2,1-4H3.
What are the key properties of 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide?
2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide has a molecular weight of 288.44 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-dimethylcycloheptyl)amino]-N,N-dimethylbenzamide is sourced from PubChem (CID 65083577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).