C18H28N2O — CID 65083034
3-[(4,4-dimethylcycloheptyl)amino]-N,2-dimethylbenzamide (PubChem CID 65083034) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 3-[(4,4-dimethylcycloheptyl)amino]-N,2-dimethylbenzamide.
| Compound Name | 3-[(4,4-dimethylcycloheptyl)amino]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 65083034 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 3-[(4,4-dimethylcycloheptyl)amino]-N,2-dimethylbenzamide |
| SMILES | CNC(=O)c1cccc(NC2CCCC(C)(C)CC2)c1C |
| InChI | InChI=1S/C18H28N2O/c1-13-15(17(21)19-4)8-5-9-16(13)20-14-7-6-11-18(2,3)12-10-14/h5,8-9,14,20H,6-7,10-12H2,1-4H3,(H,19,21) |
| InChIKey | QGVRVQCOOFHNMZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |