C14H20N2OS — CID 102670996
N,2-dimethyl-3-[(2-methylthiolan-3-yl)amino]benzamide (PubChem CID 102670996) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is N,2-dimethyl-3-[(2-methylthiolan-3-yl)amino]benzamide.
| Compound Name | N,2-dimethyl-3-[(2-methylthiolan-3-yl)amino]benzamide |
|---|---|
| PubChem CID | 102670996 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N,2-dimethyl-3-[(2-methylthiolan-3-yl)amino]benzamide |
| SMILES | CNC(=O)c1cccc(NC2CCSC2C)c1C |
| InChI | InChI=1S/C14H20N2OS/c1-9-11(14(17)15-3)5-4-6-12(9)16-13-7-8-18-10(13)2/h4-6,10,13,16H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | MCXLTZBBJQLZBX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |