C19H27N3O3 — CID 94193196
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-N'-[2-methyl-3-(methylcarbamoyl)phenyl]oxamide (PubChem CID 94193196) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-N'-[2-methyl-3-(methylcarbamoyl)phenyl]oxamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-N'-[2-methyl-3-(methylcarbamoyl)phenyl]oxamide |
|---|---|
| PubChem CID | 94193196 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-N'-[2-methyl-3-(methylcarbamoyl)phenyl]oxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)C(=O)N[C@@H]2CCC[C@@H](C)[C@@H]2C)c1C |
| InChI | InChI=1S/C19H27N3O3/c1-11-7-5-9-15(12(11)2)21-18(24)19(25)22-16-10-6-8-14(13(16)3)17(23)20-4/h6,8,10-12,15H,5,7,9H2,1-4H3,(H,20,23)(H,21,24)(H,22,25)/t11-,12+,15-/m1/s1 |
| InChIKey | QDKALSARINUACY-TYNCELHUSA-N |
| XLogP | 2.23 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|