C18H26N2 — CID 65084191
4-[1-[(4,4-dimethylcycloheptyl)amino]ethyl]benzonitrile (PubChem CID 65084191) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-[1-[(4,4-dimethylcycloheptyl)amino]ethyl]benzonitrile.
| Compound Name | 4-[1-[(4,4-dimethylcycloheptyl)amino]ethyl]benzonitrile |
|---|---|
| PubChem CID | 65084191 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 4-[1-[(4,4-dimethylcycloheptyl)amino]ethyl]benzonitrile |
| SMILES | CC(NC1CCCC(C)(C)CC1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H26N2/c1-14(16-8-6-15(13-19)7-9-16)20-17-5-4-11-18(2,3)12-10-17/h6-9,14,17,20H,4-5,10-12H2,1-3H3 |
| InChIKey | RWWLOXYYJIUCAJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |