About N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine
N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine (PubChem CID 65084515) has the molecular formula C15H29N
and a molecular weight of 223.40 g/mol. Its IUPAC name is N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine.
Molecular Properties
| Compound Name | N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine |
| PubChem CID | 65084515 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine |
| SMILES | CC1(C)CCCC(NCC2CCCC2)CC1 |
| InChI | InChI=1S/C15H29N/c1-15(2)10-5-8-14(9-11-15)16-12-13-6-3-4-7-13/h13-14,16H,3-12H2,1-2H3 |
| InChIKey | CZLHFMYQBGKJQP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine?
The IUPAC name of N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine (CID 65084515) is N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine.
What is the SMILES notation for N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine?
The canonical SMILES for N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine is CC1(C)CCCC(NCC2CCCC2)CC1.
What is the InChIKey of N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine?
The InChIKey is CZLHFMYQBGKJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N/c1-15(2)10-5-8-14(9-11-15)16-12-13-6-3-4-7-13/h13-14,16H,3-12H2,1-2H3.
What are the key properties of N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine?
N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine has a molecular weight of 223.40 g/mol, XLogP of 4.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclopentylmethyl)-4,4-dimethylcycloheptan-1-amine is sourced from PubChem (CID 65084515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).