C14H27NS — CID 80583942
4,4-dimethyl-N-(thiolan-2-ylmethyl)cycloheptan-1-amine (PubChem CID 80583942) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is 4,4-dimethyl-N-(thiolan-2-ylmethyl)cycloheptan-1-amine.
| Compound Name | 4,4-dimethyl-N-(thiolan-2-ylmethyl)cycloheptan-1-amine |
|---|---|
| PubChem CID | 80583942 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 4,4-dimethyl-N-(thiolan-2-ylmethyl)cycloheptan-1-amine |
| SMILES | CC1(C)CCCC(NCC2CCCS2)CC1 |
| InChI | InChI=1S/C14H27NS/c1-14(2)8-3-5-12(7-9-14)15-11-13-6-4-10-16-13/h12-13,15H,3-11H2,1-2H3 |
| InChIKey | ZHMRNXLOIKVIKT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |