C11H21NO2S — CID 106658875
2,2-dimethyl-N-(thiolan-2-ylmethyl)-1,3-dioxan-5-amine (PubChem CID 106658875) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 2,2-dimethyl-N-(thiolan-2-ylmethyl)-1,3-dioxan-5-amine.
| Compound Name | 2,2-dimethyl-N-(thiolan-2-ylmethyl)-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 106658875 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2,2-dimethyl-N-(thiolan-2-ylmethyl)-1,3-dioxan-5-amine |
| SMILES | CC1(C)OCC(NCC2CCCS2)CO1 |
| InChI | InChI=1S/C11H21NO2S/c1-11(2)13-7-9(8-14-11)12-6-10-4-3-5-15-10/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | VUSSRDVRAAUFMQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |