C15H27NO2S — CID 80600127
N-(thian-2-ylmethyl)-1,9-dioxaspiro[5.5]undecan-4-amine (PubChem CID 80600127) has the molecular formula C15H27NO2S and a molecular weight of 285.45 g/mol. Its IUPAC name is N-(thian-2-ylmethyl)-1,9-dioxaspiro[5.5]undecan-4-amine.
| Compound Name | N-(thian-2-ylmethyl)-1,9-dioxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 80600127 |
| Molecular Formula | C15H27NO2S |
| Molecular Weight | 285.45 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-(thian-2-ylmethyl)-1,9-dioxaspiro[5.5]undecan-4-amine |
| SMILES | C1CCC(CNC2CCOC3(CCOCC3)C2)SC1 |
| InChI | InChI=1S/C15H27NO2S/c1-2-10-19-14(3-1)12-16-13-4-7-18-15(11-13)5-8-17-9-6-15/h13-14,16H,1-12H2 |
| InChIKey | HKCJPOXPWDGNHL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |