C11H21NOS — CID 131081567
2,5-dimethyl-N-(thiolan-2-ylmethyl)oxolan-3-amine (PubChem CID 131081567) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is 2,5-dimethyl-N-(thiolan-2-ylmethyl)oxolan-3-amine.
| Compound Name | 2,5-dimethyl-N-(thiolan-2-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 131081567 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2,5-dimethyl-N-(thiolan-2-ylmethyl)oxolan-3-amine |
| SMILES | CC1CC(NCC2CCCS2)C(C)O1 |
| InChI | InChI=1S/C11H21NOS/c1-8-6-11(9(2)13-8)12-7-10-4-3-5-14-10/h8-12H,3-7H2,1-2H3 |
| InChIKey | RJGTUIPPZFTFJA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |