C11H21NOS — CID 102733755
trans-(1R,2R)-2-(thian-2-ylmethylamino)cyclopentan-1-ol (PubChem CID 102733755) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is trans-(1R,2R)-2-(thian-2-ylmethylamino)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(thian-2-ylmethylamino)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102733755 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | trans-(1R,2R)-2-(thian-2-ylmethylamino)cyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1NCC1CCCCS1 |
| InChI | InChI=1S/C11H21NOS/c13-11-6-3-5-10(11)12-8-9-4-1-2-7-14-9/h9-13H,1-8H2/t9?,10-,11-/m1/s1 |
| InChIKey | BTFKGDWAUMMJCC-FHZGLPGMSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |