C10H20N2OS — CID 130891380
(3R,4R)-4-(thian-2-ylmethylamino)pyrrolidin-3-ol (PubChem CID 130891380) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is (3R,4R)-4-(thian-2-ylmethylamino)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(thian-2-ylmethylamino)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130891380 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (3R,4R)-4-(thian-2-ylmethylamino)pyrrolidin-3-ol |
| SMILES | O[C@@H]1CNC[C@H]1NCC1CCCCS1 |
| InChI | InChI=1S/C10H20N2OS/c13-10-7-11-6-9(10)12-5-8-3-1-2-4-14-8/h8-13H,1-7H2/t8?,9-,10-/m1/s1 |
| InChIKey | ASAJSPKCPOYPBT-VXRWAFEHSA-N |
| XLogP | 0.19 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |