C10H19NO3S2 — CID 80599907
1,1-dioxo-4-(thian-2-ylmethylamino)thiolan-3-ol (PubChem CID 80599907) has the molecular formula C10H19NO3S2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 1,1-dioxo-4-(thian-2-ylmethylamino)thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-(thian-2-ylmethylamino)thiolan-3-ol |
|---|---|
| PubChem CID | 80599907 |
| Molecular Formula | C10H19NO3S2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 1,1-dioxo-4-(thian-2-ylmethylamino)thiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCC2CCCCS2)C1 |
| InChI | InChI=1S/C10H19NO3S2/c12-10-7-16(13,14)6-9(10)11-5-8-3-1-2-4-15-8/h8-12H,1-7H2 |
| InChIKey | BVMYKYYCBQQIDV-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |