C9H17NO3S — CID 60885296
4-(cyclobutylmethylamino)-1,1-dioxothiolan-3-ol (PubChem CID 60885296) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 4-(cyclobutylmethylamino)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(cyclobutylmethylamino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60885296 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 4-(cyclobutylmethylamino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCC2CCC2)C1 |
| InChI | InChI=1S/C9H17NO3S/c11-9-6-14(12,13)5-8(9)10-4-7-2-1-3-7/h7-11H,1-6H2 |
| InChIKey | OLISFYCWQYADBH-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |