C9H16F3NO3S — CID 113323221
1,1-dioxo-4-(5,5,5-trifluoropentylamino)thiolan-3-ol (PubChem CID 113323221) has the molecular formula C9H16F3NO3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 1,1-dioxo-4-(5,5,5-trifluoropentylamino)thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-(5,5,5-trifluoropentylamino)thiolan-3-ol |
|---|---|
| PubChem CID | 113323221 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1,1-dioxo-4-(5,5,5-trifluoropentylamino)thiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCCCCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3NO3S/c10-9(11,12)3-1-2-4-13-7-5-17(15,16)6-8(7)14/h7-8,13-14H,1-6H2 |
| InChIKey | VIQNNEDGPLSXPP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|