C6H10F3NO3S — CID 60665999
1,1-dioxo-4-(2,2,2-trifluoroethylamino)thiolan-3-ol (PubChem CID 60665999) has the molecular formula C6H10F3NO3S and a molecular weight of 233.21 g/mol. Its IUPAC name is 1,1-dioxo-4-(2,2,2-trifluoroethylamino)thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-(2,2,2-trifluoroethylamino)thiolan-3-ol |
|---|---|
| PubChem CID | 60665999 |
| Molecular Formula | C6H10F3NO3S |
| Molecular Weight | 233.21 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 1,1-dioxo-4-(2,2,2-trifluoroethylamino)thiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NCC(F)(F)F)C1 |
| InChI | InChI=1S/C6H10F3NO3S/c7-6(8,9)3-10-4-1-14(12,13)2-5(4)11/h4-5,10-11H,1-3H2 |
| InChIKey | CUHUXUFIJOXVMY-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.21 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |