C8H16F3NO3S — CID 86696813
2-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]ethanol (PubChem CID 86696813) has the molecular formula C8H16F3NO3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 2-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]ethanol.
| Compound Name | 2-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]ethanol |
|---|---|
| PubChem CID | 86696813 |
| Molecular Formula | C8H16F3NO3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]ethanol |
| SMILES | O=S(=O)(CCCNCCO)CCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO3S/c9-8(10,11)2-7-16(14,15)6-1-3-12-4-5-13/h12-13H,1-7H2 |
| InChIKey | XIQPKGUAVYVIRU-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|