C10H20F3NO3S — CID 86696815
2-methyl-1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-2-ol (PubChem CID 86696815) has the molecular formula C10H20F3NO3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-methyl-1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-2-ol.
| Compound Name | 2-methyl-1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 86696815 |
| Molecular Formula | C10H20F3NO3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-methyl-1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-2-ol |
| SMILES | CC(C)(O)CNCCCS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO3S/c1-9(2,15)8-14-5-3-6-18(16,17)7-4-10(11,12)13/h14-15H,3-8H2,1-2H3 |
| InChIKey | SWEOLFSCBJUUEC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|