C12H22F5NO3S — CID 86696818
2-methyl-1-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-2-ol (PubChem CID 86696818) has the molecular formula C12H22F5NO3S and a molecular weight of 355.37 g/mol. Its IUPAC name is 2-methyl-1-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-2-ol.
| Compound Name | 2-methyl-1-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-2-ol |
|---|---|
| PubChem CID | 86696818 |
| Molecular Formula | C12H22F5NO3S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-methyl-1-[3-(4,4,5,5,5-pentafluoropentylsulfonyl)propylamino]propan-2-ol |
| SMILES | CC(C)(O)CNCCCS(=O)(=O)CCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H22F5NO3S/c1-10(2,19)9-18-6-4-8-22(20,21)7-3-5-11(13,14)12(15,16)17/h18-19H,3-9H2,1-2H3 |
| InChIKey | QHPMJBSEUWCKTL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|