C9H18F3NO3S — CID 86696814
3-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-1-ol (PubChem CID 86696814) has the molecular formula C9H18F3NO3S and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-1-ol.
| Compound Name | 3-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-1-ol |
|---|---|
| PubChem CID | 86696814 |
| Molecular Formula | C9H18F3NO3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]propan-1-ol |
| SMILES | O=S(=O)(CCCNCCCO)CCC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO3S/c10-9(11,12)3-8-17(15,16)7-2-5-13-4-1-6-14/h13-14H,1-8H2 |
| InChIKey | PLGNBPKMRUOOMW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|